cas: 269718-83-4 — see every product listed under this CAS number, including other names
Pardoprunox HCl 98+% (CAS 269718-83-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A308996-1mg |
| cas | 269718-83-4 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 214.62 Pln | |
| Ambeed | 2mg | 248.00 Pln | |
| Ambeed | 5mg | 286.94 Pln | |
| Ambeed | 10mg | 409.31 Pln | |
| Ambeed | 25mg | 648.50 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A308996 |
7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride (CAS 269718-83-4) is a chemical compound with the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. IUPAC name: 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride. InChIKey: NQRIKTDKFHAOKC-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O2 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | NQRIKTDKFHAOKC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=CC3=C2OC(=O)N3.Cl |
Computed by PubChem (NCBI)