cas: 32005-36-0 — see every product listed under this CAS number, including other names
Pd(dba)2 98% (CAS 32005-36-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A107013-250mg |
| cas | 32005-36-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 715.25 Pln | |
| Ambeed | 10g | 1338.25 Pln | |
| Ambeed | 25g | 3212.81 Pln | |
| Ambeed | 100g | 12596.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A107013 |
Bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium (CAS 32005-36-0) is a chemical compound with the molecular formula C34H28O2Pd and a molecular weight of 575.0 g/mol. IUPAC name: bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium. InChIKey: UKSZBOKPHAQOMP-SVLSSHOZSA-N.
| Molecular formula | C34H28O2Pd |
|---|---|
| Molecular weight | 575.0 g/mol |
| IUPAC name | bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium |
| InChIKey | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=CC=C2.C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=CC=C2.[Pd] |
Computed by PubChem (NCBI)