cas: 114859-23-3 — see every product listed under this CAS number, including other names
Pentafluorobenzyl Methacrylate (stabilized with BHT), >98.0%(GC) (CAS 114859-23-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2546-5G |
| cas | 114859-23-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 536.31 Pln | |
| TCI | 25g | 1662.36 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
[difluoro-(2,3,4-trifluorophenyl)methyl] 2-methylprop-2-enoate (CAS 114859-23-3) is a chemical compound with the molecular formula C11H7F5O2 and a molecular weight of 266.16 g/mol. IUPAC name: [difluoro-(2,3,4-trifluorophenyl)methyl] 2-methylprop-2-enoate. InChIKey: KYOVZNUXIBOBCQ-UHFFFAOYSA-N.
| Molecular formula | C11H7F5O2 |
|---|---|
| Molecular weight | 266.16 g/mol |
| IUPAC name | [difluoro-(2,3,4-trifluorophenyl)methyl] 2-methylprop-2-enoate |
| InChIKey | KYOVZNUXIBOBCQ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC(C1=C(C(=C(C=C1)F)F)F)(F)F |
Computed by PubChem (NCBI)