CAS 911112-56-6 is the registry number for 4,4-Difluoro-1-(3-trifluoromethyl-phenyl)-butane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4,4-difluoro-1-[3-(trifluoromethyl)phenyl]butane-1,3-dione (CAS 911112-56-6) is a chemical compound with the molecular formula C11H7F5O2 and a molecular weight of 266.16 g/mol. IUPAC name: 4,4-difluoro-1-[3-(trifluoromethyl)phenyl]butane-1,3-dione. InChIKey: PVUIODSPVVRMJF-UHFFFAOYSA-N.
| Molecular formula | C11H7F5O2 |
|---|---|
| Molecular weight | 266.16 g/mol |
| IUPAC name | 4,4-difluoro-1-[3-(trifluoromethyl)phenyl]butane-1,3-dione |
| InChIKey | PVUIODSPVVRMJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)CC(=O)C(F)F |
Computed by PubChem (NCBI)