CAS 114859-23-3 appears in our catalog under these names: Pentafluorobenzyl methacrylate, 95%, Pentafluorobenzyl Methacrylate, Pentafluorobenzyl Methacrylate (stabilized with BHT), >98.0%(GC), Pentafluorobenzylmethacrylate, Pentafluorobenzyl methacrylate, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
[difluoro-(2,3,4-trifluorophenyl)methyl] 2-methylprop-2-enoate (CAS 114859-23-3) is a chemical compound with the molecular formula C11H7F5O2 and a molecular weight of 266.16 g/mol. IUPAC name: [difluoro-(2,3,4-trifluorophenyl)methyl] 2-methylprop-2-enoate. InChIKey: KYOVZNUXIBOBCQ-UHFFFAOYSA-N.
| Molecular formula | C11H7F5O2 |
|---|---|
| Molecular weight | 266.16 g/mol |
| IUPAC name | [difluoro-(2,3,4-trifluorophenyl)methyl] 2-methylprop-2-enoate |
| InChIKey | KYOVZNUXIBOBCQ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC(C1=C(C(=C(C=C1)F)F)F)(F)F |
Computed by PubChem (NCBI)