cas: 103404-90-6 — see every product listed under this CAS number, including other names
Pentanedioic acid, 2-hydroxy-, sodium salt (1:2), (2R)-, 95% (CAS 103404-90-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118XNC-1mg |
| cas | 103404-90-6 |
| size | 1mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 10mg | 107.60 Pln | |
| Chemat | 25mg | 117.20 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1269.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Disodium;(2R)-2-hydroxypentanedioate (CAS 103404-90-6) is a chemical compound with the molecular formula C5H6Na2O5 and a molecular weight of 192.08 g/mol. IUPAC name: disodium;(2R)-2-hydroxypentanedioate. InChIKey: DZHFTEDSQFPDPP-HWYNEVGZSA-L.
| Molecular formula | C5H6Na2O5 |
|---|---|
| Molecular weight | 192.08 g/mol |
| IUPAC name | disodium;(2R)-2-hydroxypentanedioate |
| InChIKey | DZHFTEDSQFPDPP-HWYNEVGZSA-L |
| SMILES | C(CC(=O)[O-])[C@H](C(=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)