CAS 1648909-80-1 appears in our catalog under these names: (2R)-2-Hydroxyglutaric Acid Disodium Salt-13C5, (2R)-2-Hydroxyglutaric Acid Disodium Salt-13C5, >95% (HPLC), D-ALPHA-HYDROXYGLUTARIC ACID-13C5 DISODI, D-α-Hydroxyglutaric acid-13C5 (disodium). Offered by: Chemat Brand, TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 0,5mg, 5mg, 10MG, 1 mg.
Disodium;(2R)-2-hydroxy(1,2,3,4,5-13C5)pentanedioate (CAS 1648909-80-1) is a chemical compound with the molecular formula C5H6Na2O5 and a molecular weight of 197.04 g/mol. IUPAC name: disodium;(2R)-2-hydroxy(1,2,3,4,5-13C5)pentanedioate. InChIKey: DZHFTEDSQFPDPP-JVBXKYRZSA-L.
| Molecular formula | C5H6Na2O5 |
|---|---|
| Molecular weight | 197.04 g/mol |
| IUPAC name | disodium;(2R)-2-hydroxy(1,2,3,4,5-13C5)pentanedioate |
| InChIKey | DZHFTEDSQFPDPP-JVBXKYRZSA-L |
| SMILES | [13CH2]([13CH2][13C](=O)[O-])[13C@H]([13C](=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)