CAS 103404-90-6 appears in our catalog under these names: (2R)-2-Hydroxyglutaric Acid Disodium Salt, (2R)-2-Hydroxyglutaric Acid Disodium Salt, >95% (HPLC), Disodium (R)–2–Hydroxyglutarate, D-α-Hydroxyglutaric acid disodium/ 98%, D-α-Hydroxyglutaric acid disodium 95%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: on request, 100mg, 10mg, 25mg, 10mM (in 1ml water), 50mg, 5mg, 200mg.
Disodium;(2R)-2-hydroxypentanedioate (CAS 103404-90-6) is a chemical compound with the molecular formula C5H6Na2O5 and a molecular weight of 192.08 g/mol. IUPAC name: disodium;(2R)-2-hydroxypentanedioate. InChIKey: DZHFTEDSQFPDPP-HWYNEVGZSA-L.
| Molecular formula | C5H6Na2O5 |
|---|---|
| Molecular weight | 192.08 g/mol |
| IUPAC name | disodium;(2R)-2-hydroxypentanedioate |
| InChIKey | DZHFTEDSQFPDPP-HWYNEVGZSA-L |
| SMILES | C(CC(=O)[O-])[C@H](C(=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)