Perfluoro-2-hydroxy-2-methylpropanoic acid 97%
cas: 662-22-6 — see every product listed under this CAS number, including other names
Perfluoro-2-hydroxy-2-methylpropanoic acid 97% (CAS 662-22-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A596616-250mg |
| cas | 662-22-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1371.62 Pln | |
| Ambeed | 10g | 2445.19 Pln | |
| Ambeed | 25g | 4686.88 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A596616 |
3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid (CAS 662-22-6) is a chemical compound with the molecular formula C4H2F6O3 and a molecular weight of 212.05 g/mol. IUPAC name: 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid. InChIKey: CMQUGOHGJUTDGZ-UHFFFAOYSA-N.
| Molecular formula | C4H2F6O3 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid |
| InChIKey | CMQUGOHGJUTDGZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(F)(F)F)(C(F)(F)F)O)O |
Computed by PubChem (NCBI)
Synonyms:
3,3,3-Trifluoro-2-hydroxy-2-(trifluoromethyl)propionic Acid, 2,2-Bis(trifluoromethyl)-2-hydroxyacetic acid, 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic Acid, 2-Hydroxy-3,3,3-trifluoro-2-(trifluoromethyl)propionic acid, 4fp1, 3,3,3-Trifluoro-2-hydroxy-2-trifluoromethylpropionic Acid, 2,2-bis-trifluoromethyl 2-hydroxyacetic acid, Perfluoro-2-hydroxy-2-methylpropanoic acid, 2-Hydroxy-2,2-bis(trifluoromethyl)acetic Acid, BFM