cas: 4358-63-8 — see every product listed under this CAS number, including other names
Phenyl benzenesulfonate, 98%, 98% (CAS 4358-63-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1184UP-100mg |
| cas | 4358-63-8 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Phenyl benzenesulfonate (CAS 4358-63-8) is a chemical compound with the molecular formula C12H10O3S and a molecular weight of 234.27 g/mol. IUPAC name: phenyl benzenesulfonate. InChIKey: CGEXUOTXYSGBLV-UHFFFAOYSA-N.
| Molecular formula | C12H10O3S |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | phenyl benzenesulfonate |
| InChIKey | CGEXUOTXYSGBLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)