CAS 1261969-21-4 is the registry number for 5-Methoxy-3-(thiophen-3-yl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-methoxy-5-thiophen-3-ylbenzoic acid (CAS 1261969-21-4) is a chemical compound with the molecular formula C12H10O3S and a molecular weight of 234.27 g/mol. IUPAC name: 3-methoxy-5-thiophen-3-ylbenzoic acid. InChIKey: CZLWEVLOUKCJJZ-UHFFFAOYSA-N.
| Molecular formula | C12H10O3S |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | 3-methoxy-5-thiophen-3-ylbenzoic acid |
| InChIKey | CZLWEVLOUKCJJZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)O)C2=CSC=C2 |
Computed by PubChem (NCBI)