Products 4358-63-8
CAS 4358-63-8 appears in our catalog under these names: Phenyl benzenesulfonate, 97%, Phenyl benzenesulfonate, 98%, 98%, Phenyl benzenesulfonate, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
Phenyl benzenesulfonate (CAS 4358-63-8) is a chemical compound with the molecular formula C12H10O3S and a molecular weight of 234.27 g/mol. IUPAC name: phenyl benzenesulfonate. InChIKey: CGEXUOTXYSGBLV-UHFFFAOYSA-N.
| Molecular formula | C12H10O3S |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | phenyl benzenesulfonate |
| InChIKey | CGEXUOTXYSGBLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)