cas: 5411-12-1 — see every product listed under this CAS number, including other names
Phenyl(3-phenyloxiran-2-yl)methanone (CAS 5411-12-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F679298-200MG |
| cas | 5411-12-1 |
| size | 200mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 200mg | 154.13 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 25g | 1997.23 Pln |
| delivery time | 3-4 weeks |
|---|
Phenyl-(3-phenyloxiran-2-yl)methanone (CAS 5411-12-1) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: phenyl-(3-phenyloxiran-2-yl)methanone. InChIKey: UQGMJZQVDNZRKT-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | phenyl-(3-phenyloxiran-2-yl)methanone |
| InChIKey | UQGMJZQVDNZRKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(O2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)