Products 3300-17-2
CAS 3300-17-2 appears in our catalog under these names: 9-Methyl-9h-fluorene-9-carboxylic acid, 95%, 9-Methyl-9H-fluorene-9-carboxylic acid, 97%, 9-Methylfluorene-9-carboxylic acid, 9-Methyl-9H-fluorene-9-carboxylic acid, 95%+(NMR),RG, 95%+(NMR),RG. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 25g, 10g, 0,5g.
9-methylfluorene-9-carboxylic acid (CAS 3300-17-2) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 9-methylfluorene-9-carboxylic acid. InChIKey: PUPWRKQSVGUBQS-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 9-methylfluorene-9-carboxylic acid |
| InChIKey | PUPWRKQSVGUBQS-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=CC=CC=C31)C(=O)O |
Computed by PubChem (NCBI)