CAS 5411-12-1 appears in our catalog under these names: 2-Benzoyl-3-phenyloxirane, 95%, 1,3-Diphenyl-2,3-epoxy-1-propanone, >98.0%(GC), Chalcone epoxide, 98%, 98%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
Phenyl-(3-phenyloxiran-2-yl)methanone (CAS 5411-12-1) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: phenyl-(3-phenyloxiran-2-yl)methanone. InChIKey: UQGMJZQVDNZRKT-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | phenyl-(3-phenyloxiran-2-yl)methanone |
| InChIKey | UQGMJZQVDNZRKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(O2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)