cas: 39930-11-5 — see every product listed under this CAS number, including other names
Phenyl(pyridin-2-yl)methanamine 95% (CAS 39930-11-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A123612-100mg |
| cas | 39930-11-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 676.31 Pln | |
| Ambeed | 10g | 1121.31 Pln | |
| Ambeed | 25g | 2178.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A123612 |
Phenyl(pyridin-2-yl)methanamine (CAS 39930-11-5) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: phenyl(pyridin-2-yl)methanamine. InChIKey: BAEZXIOBOOEPOS-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | phenyl(pyridin-2-yl)methanamine |
| InChIKey | BAEZXIOBOOEPOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=N2)N |
Computed by PubChem (NCBI)