cas: 39142-40-0 — see every product listed under this CAS number, including other names
Phenyl1,3-thiazol-2-ylcarbamate, 95% (CAS 39142-40-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A191052-10g |
| cas | 39142-40-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19365.64 Pln | |
| AmBeed | 5g | 12341.35 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Phenyl N-(1,3-thiazol-2-yl)carbamate (CAS 39142-40-0) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: phenyl N-(1,3-thiazol-2-yl)carbamate. InChIKey: CXVVRXLSXHPYDR-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | phenyl N-(1,3-thiazol-2-yl)carbamate |
| InChIKey | CXVVRXLSXHPYDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NC2=NC=CS2 |
Computed by PubChem (NCBI)