cas: 36122-35-7 — see every product listed under this CAS number, including other names
Phenylmaleic Anhydride, >98.0%(GC)(T) (CAS 36122-35-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2096-1G |
| cas | 36122-35-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 295.37 Pln | |
| TCI | 5g | 964.11 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
3-phenylfuran-2,5-dione (CAS 36122-35-7) is a chemical compound with the molecular formula C10H6O3 and a molecular weight of 174.15 g/mol. IUPAC name: 3-phenylfuran-2,5-dione. InChIKey: QZYCWJVSPFQUQC-UHFFFAOYSA-N.
| Molecular formula | C10H6O3 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | 3-phenylfuran-2,5-dione |
| InChIKey | QZYCWJVSPFQUQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)OC2=O |
Computed by PubChem (NCBI)