cas: 4333-22-6 — see every product listed under this CAS number, including other names
Phenylthiohydantoin-norleucine, 97%(LC-MS),RG, 97%(LC-MS),RG (CAS 4333-22-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TQF-100mg |
| cas | 4333-22-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 500mg | 400.40 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1624.40 Pln |
| purity | 97%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
5-butyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (CAS 4333-22-6) is a chemical compound with the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. IUPAC name: 5-butyl-3-phenyl-2-sulfanylideneimidazolidin-4-one. InChIKey: FJQCWUDEVCYMRZ-UHFFFAOYSA-N.
| Molecular formula | C13H16N2OS |
|---|---|
| Molecular weight | 248.35 g/mol |
| IUPAC name | 5-butyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| InChIKey | FJQCWUDEVCYMRZ-UHFFFAOYSA-N |
| SMILES | CCCCC1C(=O)N(C(=S)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)