CAS 353495-22-4 appears in our catalog under these names: Phox-I2/ 99.52% (existing batch purity), Phox–I2, Phox-I2, 8-Nitro-4-(3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline, 95%, 95%, Phox-I2, 99.44%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 2mg.
8-nitro-4-(3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (CAS 353495-22-4) is a chemical compound with the molecular formula C18H15N3O4 and a molecular weight of 337.3 g/mol. IUPAC name: 8-nitro-4-(3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline. InChIKey: PADQUVZDTGNTLH-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O4 |
|---|---|
| Molecular weight | 337.3 g/mol |
| IUPAC name | 8-nitro-4-(3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| InChIKey | PADQUVZDTGNTLH-UHFFFAOYSA-N |
| SMILES | C1C=CC2C1C(NC3=C2C=C(C=C3)[N+](=O)[O-])C4=CC(=CC=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)