cas: 487-36-5 — see every product listed under this CAS number, including other names
Pinoresinol, 95%, 95% (CAS 487-36-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9SY-1mg |
| cas | 487-36-5 |
| size | 1mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 126.80 Pln | |
| Chemat | 10mg | 453.20 Pln | |
| Chemat | 25mg | 726.80 Pln | |
| Chemat | 50mg | 1130.00 Pln | |
| Chemat | 100mg | 1768.40 Pln | |
| Chemat | 250mg | 2958.80 Pln | |
| Chemat | 1g | 7888.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(+)-pinoresinol is an enantiomer of pinoresinol having (+)-1S,3aR,4S,6aR-configuration. It has a role as a hypoglycemic agent, a plant metabolite and a phytoestrogen.
Source: ChEBI
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
| InChIKey | HGXBRUKMWQGOIE-AFHBHXEDSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC)O |
Computed by PubChem (NCBI)