cas: 16015-70-6 — see every product listed under this CAS number, including other names
Piperazine, 1-(3-methoxyphenyl)-, hydrochloride (1:1), 95%, 95% (CAS 16015-70-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AKCG-5g |
| cas | 16015-70-6 |
| size | 5g |
| availability | 3500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 100g | 515.60 Pln | |
| Chemat | 500g | 1732.80 Pln | |
| Chemat | 10g | 150.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-methoxyphenyl)piperazine;hydrochloride (CAS 16015-70-6) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: 1-(3-methoxyphenyl)piperazine;hydrochloride. InChIKey: QOQLPYRYJCBRNU-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)piperazine;hydrochloride |
| InChIKey | QOQLPYRYJCBRNU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2CCNCC2.Cl |
Computed by PubChem (NCBI)