Products 2714417-76-0
CAS 2714417-76-0 is the registry number for Piroctone Olamine-d3. Offered by: TRC. Available pack sizes: 25mg.
2-aminoethanol;6-[4,4-dimethyl-2-(trideuteriomethyl)pentyl]-1-hydroxy-4-methylpyridin-2-one (CAS 2714417-76-0) is a chemical compound with the molecular formula C16H30N2O3 and a molecular weight of 301.44 g/mol. IUPAC name: 2-aminoethanol;6-[4,4-dimethyl-2-(trideuteriomethyl)pentyl]-1-hydroxy-4-methylpyridin-2-one. InChIKey: BTSZTGGZJQFALU-MUTAZJQDSA-N.
| Molecular formula | C16H30N2O3 |
|---|---|
| Molecular weight | 301.44 g/mol |
| IUPAC name | 2-aminoethanol;6-[4,4-dimethyl-2-(trideuteriomethyl)pentyl]-1-hydroxy-4-methylpyridin-2-one |
| InChIKey | BTSZTGGZJQFALU-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])C(CC1=CC(=CC(=O)N1O)C)CC(C)(C)C.C(CO)N |
Computed by PubChem (NCBI)
Synonyms:
Piroctone Olamine-d3