Products 864293-17-4

CAS 864293-17-4 is the registry number for tert-Butyl 3-(hydroxymethyl)-(1,4'-bipiperidine)-1'-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-[3-(hydroxymethyl)piperidin-1-yl]piperidine-1-carboxylate (CAS 864293-17-4) is a chemical compound with the molecular formula C16H30N2O3 and a molecular weight of 298.42 g/mol. IUPAC name: tert-butyl 4-[3-(hydroxymethyl)piperidin-1-yl]piperidine-1-carboxylate. InChIKey: GAZKWALREOBSLR-UHFFFAOYSA-N.

Identity
Molecular formulaC16H30N2O3
Molecular weight298.42 g/mol
IUPAC nametert-butyl 4-[3-(hydroxymethyl)piperidin-1-yl]piperidine-1-carboxylate
InChIKeyGAZKWALREOBSLR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)N2CCCC(C2)CO

Computed by PubChem (NCBI)