Podofilox, 99.92%
cas: 518-28-5 — see every product listed under this CAS number, including other names
Podofilox, 99.92% (CAS 518-28-5) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 10 g, 10mM/1mL, 500 mg, 1 g, 100 mg, 50 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-15552-25 g |
| cas | 518-28-5 |
| size | 25 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 2181.94 Pln | |
| MedChemExpress | 10 g | 1415.68 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 500 mg | 505.45 Pln | |
| MedChemExpress | 1 g | 579.76 Pln | |
| MedChemExpress | 100 mg | 263.96 Pln | |
| MedChemExpress | 50 g | 3120.02 Pln | |
| MedChemExpress | 5 g | 1039.51 Pln | |
| MedChemExpress | 100 g | 4485.36 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.92% |
Podophyllotoxin is an organic heterotetracyclic compound that has a furonaphthodioxole skeleton bearing a 3,4,5-trimethoxyphenyl substituent. It is found in the roots and rhizomes of Podophyllum species and is used for the topical treatment of genital warts. It has a role as an antineoplastic agent, a keratolytic drug, a tubulin modulator, a microtubule-destabilising agent, an antimitotic and a plant metabolite. It is a lignan, an organic heterotetracyclic compound and a furonaphthodioxole.
Source: ChEBI
| Molecular formula | C22H22O8 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | (5R,5aR,8aR,9R)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| InChIKey | YJGVMLPVUAXIQN-XVVDYKMHSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@@H]3[C@H](COC3=O)[C@H](C4=CC5=C(C=C24)OCO5)O |
Computed by PubChem (NCBI)