CAS 2225940-46-3 appears in our catalog under these names: 3-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)propanoic acid, 96%, 96%, Pomalidomide-C2-acid/ 97.76% (existing batch purity), Pomalidomide-C2-acid 95%, Pomalidomide-C2-acid, 99.78%, Pomalidomide-C2-acid, 96%. Offered by: Chemat, TargetMol, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 1mg, 2mg, 5mg, 10mg.
3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propanoic acid (CAS 2225940-46-3) is a chemical compound with the molecular formula C16H15N3O6 and a molecular weight of 345.31 g/mol. IUPAC name: 3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propanoic acid. InChIKey: HIZAHNGGMCSUEV-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O6 |
|---|---|
| Molecular weight | 345.31 g/mol |
| IUPAC name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propanoic acid |
| InChIKey | HIZAHNGGMCSUEV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCC(=O)O |
Computed by PubChem (NCBI)