cas: 1430219-72-9 — see every product listed under this CAS number, including other names
Potassium (1-(tert-butoxycarbonyl)pyrrolidin-3-yl)trifluoroborate 98+% (CAS 1430219-72-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A693433-100mg |
| cas | 1430219-72-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1471.75 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A693433 |
Potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide (CAS 1430219-72-9) is a chemical compound with the molecular formula C9H16BF3KNO2 and a molecular weight of 277.14 g/mol. IUPAC name: potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide. InChIKey: ZZTWIERFLVKQOX-UHFFFAOYSA-N.
| Molecular formula | C9H16BF3KNO2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]boranuide |
| InChIKey | ZZTWIERFLVKQOX-UHFFFAOYSA-N |
| SMILES | [B-](C1CCN(C1)C(=O)OC(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)