cas: 578-36-9 — see every product listed under this CAS number, including other names
Potassium 2-hydroxybenzoate 95% (CAS 578-36-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A358019-1g |
| cas | 578-36-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 10g | 470.50 Pln | |
| Ambeed | 25g | 893.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A358019 |
Potassium 2-hydroxybenzoate (CAS 578-36-9) is a chemical compound with the molecular formula C7H5KO3 and a molecular weight of 176.21 g/mol. IUPAC name: potassium 2-hydroxybenzoate. InChIKey: FRMWBRPWYBNAFB-UHFFFAOYSA-M.
| Molecular formula | C7H5KO3 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | potassium 2-hydroxybenzoate |
| InChIKey | FRMWBRPWYBNAFB-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)