CAS 578-36-9 appears in our catalog under these names: Potassium salicylate, 95%, Potassium salicylate, Potassium 2-hydroxybenzoate 95%, Potassium salicylate, 96%, 96%, Potassium salicylate, min. 95 %, 2 g. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Roth. Available pack sizes: 5g, 1g, 2g, 10g, 25g, 100mg, 250mg, 100g.
Potassium 2-hydroxybenzoate (CAS 578-36-9) is a chemical compound with the molecular formula C7H5KO3 and a molecular weight of 176.21 g/mol. IUPAC name: potassium 2-hydroxybenzoate. InChIKey: FRMWBRPWYBNAFB-UHFFFAOYSA-M.
| Molecular formula | C7H5KO3 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | potassium 2-hydroxybenzoate |
| InChIKey | FRMWBRPWYBNAFB-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)