cas: 578-36-9 — see every product listed under this CAS number, including other names
Potassium salicylate, 96%, 96% (CAS 578-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAAG-100mg |
| cas | 578-36-9 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 10g | 424.40 Pln | |
| Chemat | 25g | 765.20 Pln | |
| Chemat | 100g | 2128.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Potassium 2-hydroxybenzoate (CAS 578-36-9) is a chemical compound with the molecular formula C7H5KO3 and a molecular weight of 176.21 g/mol. IUPAC name: potassium 2-hydroxybenzoate. InChIKey: FRMWBRPWYBNAFB-UHFFFAOYSA-M.
| Molecular formula | C7H5KO3 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | potassium 2-hydroxybenzoate |
| InChIKey | FRMWBRPWYBNAFB-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)