cas: 1023357-63-2 — see every product listed under this CAS number, including other names
Potassium trifluoro(3-methoxy-3-oxopropyl)borate 95% (CAS 1023357-63-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A198687-250mg |
| cas | 1023357-63-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 10g | 2167.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A198687 |
Potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide (CAS 1023357-63-2) is a chemical compound with the molecular formula C4H7BF3KO2 and a molecular weight of 194.00 g/mol. IUPAC name: potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide. InChIKey: NPWJZDRICBCMOK-UHFFFAOYSA-N.
| Molecular formula | C4H7BF3KO2 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide |
| InChIKey | NPWJZDRICBCMOK-UHFFFAOYSA-N |
| SMILES | [B-](CCC(=O)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)