cas: 1023357-63-2 — see every product listed under this CAS number, including other names
Potassium trifluoro(3-methoxy-3-oxopropyl)borate, 98%, 98% (CAS 1023357-63-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11188G-100mg |
| cas | 1023357-63-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 1062.80 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 3227.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide (CAS 1023357-63-2) is a chemical compound with the molecular formula C4H7BF3KO2 and a molecular weight of 194.00 g/mol. IUPAC name: potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide. InChIKey: NPWJZDRICBCMOK-UHFFFAOYSA-N.
| Molecular formula | C4H7BF3KO2 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | potassium trifluoro-(3-methoxy-3-oxopropyl)boranuide |
| InChIKey | NPWJZDRICBCMOK-UHFFFAOYSA-N |
| SMILES | [B-](CCC(=O)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)