cas: 93778-31-5 — see every product listed under this CAS number, including other names
Potassium 4–methyl–2–oxopentanoate (CAS 93778-31-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 100g, 10g, 1g, 2,5g, 250mg, 25g, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB60565-100 |
| cas | 93778-31-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 742.14 Pln | |
| GLPBio | 100g | 9714.65 Pln | |
| GLPBio | 10g | 2572.21 Pln | |
| GLPBio | 1g | 779.58 Pln | |
| GLPBio | 2,5g | 1158.70 Pln | |
| GLPBio | 250mg | 751.50 Pln | |
| GLPBio | 25g | 3929.56 Pln | |
| GLPBio | 50mg | 728.09 Pln | |
| GLPBio | 500mg | 770.22 Pln | |
| GLPBio | 50g | 5848.56 Pln | |
| GLPBio | 5g | 1781.21 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Potassium 4-methyl-2-oxopentanoate (CAS 93778-31-5) is a chemical compound with the molecular formula C6H9KO3 and a molecular weight of 168.23 g/mol. IUPAC name: potassium 4-methyl-2-oxopentanoate. InChIKey: LBVGRCMWWGZGED-UHFFFAOYSA-M.
| Molecular formula | C6H9KO3 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | potassium 4-methyl-2-oxopentanoate |
| InChIKey | LBVGRCMWWGZGED-UHFFFAOYSA-M |
| SMILES | CC(C)CC(=O)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)