CAS 2227199-07-5 appears in our catalog under these names: Trans-3-hydroxy-3-methylcyclobutanecarboxylic acid potassium salt, 95%, trans-3-hydroxy-3-methylcyclobutanecarboxylic acid Potassium salt, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
Potassium 3-hydroxy-3-methylcyclobutane-1-carboxylate (CAS 2227199-07-5) is a chemical compound with the molecular formula C6H9KO3 and a molecular weight of 168.23 g/mol. IUPAC name: potassium 3-hydroxy-3-methylcyclobutane-1-carboxylate. InChIKey: OHCJVRHQYABSIO-UHFFFAOYSA-M.
| Molecular formula | C6H9KO3 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | potassium 3-hydroxy-3-methylcyclobutane-1-carboxylate |
| InChIKey | OHCJVRHQYABSIO-UHFFFAOYSA-M |
| SMILES | CC1(CC(C1)C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)