CAS 93778-31-5 is the registry number for Potassium 4–methyl–2–oxopentanoate. Offered by: GLPBio. Available pack sizes: 100mg, 100g, 10g, 1g, 2,5g, 250mg, 25g, 50mg.
Potassium 4-methyl-2-oxopentanoate (CAS 93778-31-5) is a chemical compound with the molecular formula C6H9KO3 and a molecular weight of 168.23 g/mol. IUPAC name: potassium 4-methyl-2-oxopentanoate. InChIKey: LBVGRCMWWGZGED-UHFFFAOYSA-M.
| Molecular formula | C6H9KO3 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | potassium 4-methyl-2-oxopentanoate |
| InChIKey | LBVGRCMWWGZGED-UHFFFAOYSA-M |
| SMILES | CC(C)CC(=O)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)