cas: 637-58-1 — see every product listed under this CAS number, including other names
Pramoxine Hydrochloride (CAS 637-58-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10mg, 100mg, 200MG, 1x100mg, 1x50mg, 1g, 5g. Offered by: Mikromol, LoGiCal, Dr. Ehrenstorfer, Sigma-Aldrich.
| brand | Mikromol |
|---|---|
| catalog number | MM3228.00 |
| cas | 637-58-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Mikromol | 250mg | price on request | |
| LoGiCal | 10mg | price on request | |
| Dr. Ehrenstorfer | 100mg | price on request | |
| Sigma-Aldrich | 200MG | 1659.00 Pln | |
| HPC Standards | 1x100mg | 421.16 Pln | |
| HPC Standards | 1x50mg | 421.16 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 268.67 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 940.31 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Pramoxine hydrochloride is an aromatic ether.
Source: ChEBI
| Molecular formula | C17H28ClNO3 |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | 4-[3-(4-butoxyphenoxy)propyl]morpholine;hydrochloride |
| InChIKey | SYCBXBCPLUFJID-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)OCCCN2CCOCC2.Cl |
Computed by PubChem (NCBI)