Prilocaine, 98%, 98%
cas: 721-50-6 — see every product listed under this CAS number, including other names
Prilocaine, 98%, 98% (CAS 721-50-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1170T0-100mg |
| cas | 721-50-6 |
| size | 100mg |
| availability | 862g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 50g | 371.60 Pln | |
| Chemat | 100g | 650.00 Pln | |
| Chemat | 250g | 1163.60 Pln | |
| Chemat | 500g | 1924.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Prilocaine is an amino acid amide in which N-propyl-DL-alanine and 2-methylaniline have combined to form the amide bond; used as a local anaesthetic. It has a role as an anticonvulsant and a local anaesthetic. It is an amino acid amide and a monocarboxylic acid amide.
Source: ChEBI
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | N-(2-methylphenyl)-2-(propylamino)propanamide |
| InChIKey | MVFGUOIZUNYYSO-UHFFFAOYSA-N |
| SMILES | CCCNC(C)C(=O)NC1=CC=CC=C1C |
Computed by PubChem (NCBI)