cas: 913074-13-2 — see every product listed under this CAS number, including other names
Propargyl α-D-Galactopyranoside (CAS 913074-13-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM08990C-100mg |
| cas | 913074-13-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2048.00 Pln | |
| Chemat | 1g | 10159.67 Pln | |
| Chemat | 250mg | 3855.00 Pln | |
| Chemat | 500mg | 6224.36 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol (CAS 913074-13-2) is a chemical compound with the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol. InChIKey: DSKUDOWHGLWCBQ-NXRLNHOXSA-N.
| Molecular formula | C9H14O6 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol |
| InChIKey | DSKUDOWHGLWCBQ-NXRLNHOXSA-N |
| SMILES | C#CCO[C@@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)