cas: 854262-01-4 — see every product listed under this CAS number, including other names
Propargyl α-D-mannopyranoside, 98%, 98% (CAS 854262-01-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IDNW-25mg |
| cas | 854262-01-4 |
| size | 25mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 434.00 Pln | |
| Chemat | 50mg | 741.20 Pln | |
| Chemat | 100mg | 894.80 Pln | |
| Chemat | 250mg | 1480.40 Pln | |
| Chemat | 1g | 5598.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol (CAS 854262-01-4) is a chemical compound with the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. IUPAC name: (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol. InChIKey: DSKUDOWHGLWCBQ-DFTQBPQZSA-N.
| Molecular formula | C9H14O6 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-prop-2-ynoxyoxane-3,4,5-triol |
| InChIKey | DSKUDOWHGLWCBQ-DFTQBPQZSA-N |
| SMILES | C#CCO[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)