cas: 2055014-94-1 — see every product listed under this CAS number, including other names
Propargyl–PEG8–acid (CAS 2055014-94-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 25mg, 250mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC66303-100 |
| cas | 2055014-94-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 1388.04 Pln | |
| GLPBio | 25mg | 728.09 Pln | |
| GLPBio | 250mg | 1907.58 Pln | |
| GLPBio | 50mg | 910.63 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055014-94-1) is a chemical compound with the molecular formula C20H36O10 and a molecular weight of 436.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QZQUQXNQKWZDNM-UHFFFAOYSA-N.
| Molecular formula | C20H36O10 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QZQUQXNQKWZDNM-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)