cas: 2055014-94-1 — see every product listed under this CAS number, including other names
Propargyl-PEG8-acid 95% (CAS 2055014-94-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755332-100mg |
| cas | 2055014-94-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 581.75 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755332 |
3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055014-94-1) is a chemical compound with the molecular formula C20H36O10 and a molecular weight of 436.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QZQUQXNQKWZDNM-UHFFFAOYSA-N.
| Molecular formula | C20H36O10 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QZQUQXNQKWZDNM-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)