Propargyl-PEG8-acid, 98.0%
cas: 2055014-94-1 — see every product listed under this CAS number, including other names
Propargyl-PEG8-acid, 98.0% (CAS 2055014-94-1) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 100 mg, 5 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-130379-1 g |
| cas | 2055014-94-1 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 760.87 Pln | |
| MedChemExpress | 100 mg | 263.96 Pln | |
| MedChemExpress | 5 g | 2878.54 Pln | |
| MedChemExpress | 250 mg | 366.13 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055014-94-1) is a chemical compound with the molecular formula C20H36O10 and a molecular weight of 436.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QZQUQXNQKWZDNM-UHFFFAOYSA-N.
| Molecular formula | C20H36O10 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QZQUQXNQKWZDNM-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)