cas: 24556-15-8 — see every product listed under this CAS number, including other names
Propyl adamantane-1-carboxylate, 95+% (CAS 24556-15-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A681725-250mg |
| cas | 24556-15-8 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 577.78 Pln | |
| AmBeed | 10g | 6501.88 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Propyl adamantane-1-carboxylate (CAS 24556-15-8) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: propyl adamantane-1-carboxylate. InChIKey: LVGMTYKQVATOOP-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | propyl adamantane-1-carboxylate |
| InChIKey | LVGMTYKQVATOOP-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)