cas: 25940-35-6 — see every product listed under this CAS number, including other names
Pyrazolo[1,5-A]Pyrimidine-3-Carboxylic Acid, 98%, 98% (CAS 25940-35-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113R6L-1g |
| cas | 25940-35-6 |
| size | 1g |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 15g | 222.80 Pln | |
| Chemat | 25g | 323.60 Pln | |
| Chemat | 50g | 501.20 Pln | |
| Chemat | 100g | 722.00 Pln | |
| Chemat | 250g | 1662.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid (CAS 25940-35-6) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: pyrazolo[1,5-a]pyrimidine-3-carboxylic acid. InChIKey: HNYVPKNVKSTVJO-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| InChIKey | HNYVPKNVKSTVJO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)