cas: 25940-35-6 — see every product listed under this CAS number, including other names
Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid 97% (CAS 25940-35-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A279132-500g |
| cas | 25940-35-6 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 3757.94 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 325.88 Pln | |
| Ambeed | 25g | 448.25 Pln | |
| Ambeed | 100g | 993.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A279132 |
Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid (CAS 25940-35-6) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: pyrazolo[1,5-a]pyrimidine-3-carboxylic acid. InChIKey: HNYVPKNVKSTVJO-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| InChIKey | HNYVPKNVKSTVJO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)