Pyridine-3-sulfonyl chloride hydrochloride, 95%
cas: 42899-76-3 — see every product listed under this CAS number, including other names
Pyridine-3-sulfonyl chloride hydrochloride, 95% (CAS 42899-76-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 25g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 451480050 |
| cas | 42899-76-3 |
| size | 5g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 904.25 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1070.47 Pln | |
| Fluorochem | 25g | 1757.73 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
Pyridine-3-sulfonyl chloride;hydrochloride (CAS 42899-76-3) is a chemical compound with the molecular formula C5H5Cl2NO2S and a molecular weight of 214.07 g/mol. IUPAC name: pyridine-3-sulfonyl chloride;hydrochloride. InChIKey: VIVPWOMJFLICOZ-UHFFFAOYSA-N.
| Molecular formula | C5H5Cl2NO2S |
|---|---|
| Molecular weight | 214.07 g/mol |
| IUPAC name | pyridine-3-sulfonyl chloride;hydrochloride |
| InChIKey | VIVPWOMJFLICOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Pyridine-3-sulfonyl chloride hydrochloride, Pyridine-3-sulfonyl chloride HCl, 3-Pyridinesulfonyl chloride, hydrochloride, 3-Pyridinesulfonyl chloride hydrochloride, pyridine-3-sulfonyl chloride;hydrochloride, pyridine-3-sulphonyl chloride hydrochloride, Vonoprazan Impurity C, 3-pyridylsulfonylchloride HCl, 3-pyridinesulphonylchloride-hcl, chloro-3-pyridylsulfone, chloride