CAS 489430-50-4 is the registry number for Pyridine-4-sulfonyl chloride hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25mg.
Pyridine-4-sulfonyl chloride;hydrochloride (CAS 489430-50-4) is a chemical compound with the molecular formula C5H5Cl2NO2S and a molecular weight of 214.07 g/mol. IUPAC name: pyridine-4-sulfonyl chloride;hydrochloride. InChIKey: ZBDTZCIVBAUGNG-UHFFFAOYSA-N.
| Molecular formula | C5H5Cl2NO2S |
|---|---|
| Molecular weight | 214.07 g/mol |
| IUPAC name | pyridine-4-sulfonyl chloride;hydrochloride |
| InChIKey | ZBDTZCIVBAUGNG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)