CAS 42899-76-3 appears in our catalog under these names: 3-Pyridinesulfonyl chloride hydrochloride, 95%, Pyridine-3-sulfonyl chloride hydrochloride, 95%, Pyridine-3-sulfonyl chloride hydrochloride, 95% . Offered by: Combi-blocks, Thermo Scientific (Acros), Thermo Scientific, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250MG, 1g, 10g.
Pyridine-3-sulfonyl chloride;hydrochloride (CAS 42899-76-3) is a chemical compound with the molecular formula C5H5Cl2NO2S and a molecular weight of 214.07 g/mol. IUPAC name: pyridine-3-sulfonyl chloride;hydrochloride. InChIKey: VIVPWOMJFLICOZ-UHFFFAOYSA-N.
| Molecular formula | C5H5Cl2NO2S |
|---|---|
| Molecular weight | 214.07 g/mol |
| IUPAC name | pyridine-3-sulfonyl chloride;hydrochloride |
| InChIKey | VIVPWOMJFLICOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)