cas: 118768-13-1 — see every product listed under this CAS number, including other names
Pyrrolo[1,2-b]pyridazine-6-carboxylic acid, 97% (CAS 118768-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318085-100MG |
| cas | 118768-13-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 2569.95 Pln | |
| Fluorochem | 5g | 12628.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Pyrrolo[1,2-b]pyridazine-6-carboxylic acid (CAS 118768-13-1) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: pyrrolo[1,2-b]pyridazine-6-carboxylic acid. InChIKey: SLVBZCDHIKVNNN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | pyrrolo[1,2-b]pyridazine-6-carboxylic acid |
| InChIKey | SLVBZCDHIKVNNN-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN2N=C1)C(=O)O |
Computed by PubChem (NCBI)