cas: 251102-27-9 — see every product listed under this CAS number, including other names
Pyrrolo[1,2-c]pyrimidine-3-carboxylic acid, 97% (CAS 251102-27-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093165-250MG |
| cas | 251102-27-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1919.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Pyrrolo[1,2-c]pyrimidine-3-carboxylic acid (CAS 251102-27-9) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: pyrrolo[1,2-c]pyrimidine-3-carboxylic acid. InChIKey: OAZGQWMFODAEEV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | pyrrolo[1,2-c]pyrimidine-3-carboxylic acid |
| InChIKey | OAZGQWMFODAEEV-UHFFFAOYSA-N |
| SMILES | C1=CN2C=NC(=CC2=C1)C(=O)O |
Computed by PubChem (NCBI)